2-Methyl-7-(trifluoromethyl)quinoline structure
|
Common Name | 2-Methyl-7-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 324-32-3 | Molecular Weight | 211.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 253.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H8F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.9±25.9 °C | |
| Name | 2-Methyl-7-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 253.1±35.0 °C at 760 mmHg |
| Molecular Formula | C11H8F3N |
| Molecular Weight | 211.183 |
| Flash Point | 106.9±25.9 °C |
| Exact Mass | 211.060883 |
| PSA | 12.89000 |
| LogP | 3.48 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | VIBTYGFMDABZCD-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ccc(C(F)(F)F)cc2n1 |
| HS Code | 2933499090 |
|---|
|
~29%
2-Methyl-7-(tri... CAS#:324-32-3 |
| Literature: ARRAY BIOPHARMA INC.; BLAKE, James, F; DELISLE, Robert, Kirk; DE MEESE, Lisa, A.; GRAHAM, James, M.; LE HUEROU, Yvan; LYON, Michael; ROBINSON, John, E.; WALLACE, Eli, M.; WANG, Bin; XU, Rui Patent: WO2012/154274 A1, 2012 ; Location in patent: Page/Page column 87-88 ; WO 2012/154274 A1 |
|
~61%
2-Methyl-7-(tri... CAS#:324-32-3 |
| Literature: Polanski, Jaroslaw; Zouhiri, Fatima; Jeanson, Laurence; Desmaele, Didier; D'Angelo, Jean; Mouscadet, Jean-Francois; Gieleciak, Rafal; Gasteiger, Johann; Le Bret, Marc Journal of Medicinal Chemistry, 2002 , vol. 45, # 21 p. 4647 - 4654 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methyl-7-trifluoromethylquinoline |
| 2-Methyl-7-(trifluoromethyl)quinoline |
| 2-Methyl-7-trifluormethyl-chinolin |
| Quinoline, 2-methyl-7-(trifluoromethyl)- |
| 7-trifluoromethylquinaldine |