2,2diBzSMegly structure
|
Common Name | 2,2diBzSMegly | ||
|---|---|---|---|---|
| CAS Number | 32418-96-5 | Molecular Weight | 347.49500 | |
| Density | 1.262g/cm3 | Boiling Point | 532.7ºC at 760 mmHg | |
| Molecular Formula | C18H21NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9ºC | |
| Name | 2-amino-3-benzylsulfanyl-2-(benzylsulfanylmethyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 532.7ºC at 760 mmHg |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.49500 |
| Flash Point | 275.9ºC |
| Exact Mass | 347.10100 |
| PSA | 113.92000 |
| LogP | 4.33560 |
| Index of Refraction | 1.645 |
| InChIKey | WQOMXPBOQJIKPN-UHFFFAOYSA-N |
| SMILES | NC(CSCc1ccccc1)(CSCc1ccccc1)C(=O)O |
| HS Code | 2930909090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of HIV-1 RF viral production in MT-2 cells.
Source: ChEMBL
Target: Human immunodeficiency virus type 1 (RF/HAT ISOLATE)
External Id: CHEMBL712240
|
|
Name: Inhibition of HIV-1 RF induced cytotoxicity in CEM cells; Inactive.
Source: ChEMBL
Target: CCRF-CEM
External Id: CHEMBL656418
|
|
Name: Compound was tested for antiviral activity by measuring its ability to inhibit HIV in...
Source: ChEMBL
Target: CCRF-CEM
External Id: CHEMBL656584
|
|
Name: Inhibition of HIV-1 RF induced cytotoxicity in MT-2 cells; Inactive.
Source: ChEMBL
Target: MT2
External Id: CHEMBL711406
|
| 2,2diBzSMegly |