1,2,3,4-Tetrahydro-N-[2-(diethylamino)ethyl]-1-naphthalenecarboxamide structure
|
Common Name | 1,2,3,4-Tetrahydro-N-[2-(diethylamino)ethyl]-1-naphthalenecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 32421-49-1 | Molecular Weight | 274.40100 | |
| Density | 1.031g/cm3 | Boiling Point | 454.4ºC at 760 mmHg | |
| Molecular Formula | C17H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | N-[2-(diethylamino)ethyl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 454.4ºC at 760 mmHg |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.40100 |
| Flash Point | 228.6ºC |
| Exact Mass | 274.20500 |
| PSA | 35.83000 |
| LogP | 3.40480 |
| Index of Refraction | 1.534 |
| InChIKey | IAZRYSOMPVFZNF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1CCCc2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |