Ac-Ser-Gly-OH structure
|
Common Name | Ac-Ser-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 3244-65-3 | Molecular Weight | 204.18100 | |
| Density | 1.375g/cm3 | Boiling Point | 669.8ºC at 760mmHg | |
| Molecular Formula | C7H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.9ºC | |
| Name | Ac-Ser-Gly-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 669.8ºC at 760mmHg |
| Molecular Formula | C7H12N2O5 |
| Molecular Weight | 204.18100 |
| Flash Point | 358.9ºC |
| Exact Mass | 204.07500 |
| PSA | 115.73000 |
| Index of Refraction | 1.515 |
| InChIKey | DZSFFSREGMDONQ-YFKPBYRVSA-N |
| SMILES | CC(=O)NC(CO)C(=O)NCC(=O)O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[[(2S)-2-acetamido-3-hydroxy-propanoyl]amino]ethanoic acid |
| 2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]acetic acid |
| N-Acetyl-L-seryl-glycin |
| N-acetylserylglycine |