Carbamic acid,diphenyl-, 1-methyl-3-piperidyl ester, hydrochloride (7CI,8CI) structure
|
Common Name | Carbamic acid,diphenyl-, 1-methyl-3-piperidyl ester, hydrochloride (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3245-17-8 | Molecular Weight | 346.85100 | |
| Density | 1.18g/cm3 | Boiling Point | 437ºC at 760mmHg | |
| Molecular Formula | C19H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | (1-methylpiperidin-3-yl) N,N-diphenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 437ºC at 760mmHg |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.85100 |
| Flash Point | 218.1ºC |
| Exact Mass | 346.14500 |
| PSA | 32.78000 |
| LogP | 4.79540 |
| Index of Refraction | 1.613 |
| InChIKey | ZDYWHUBLLDNCHL-UHFFFAOYSA-N |
| SMILES | CN1CCCC(OC(=O)N(c2ccccc2)c2ccccc2)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| diphenyl-carbamic acid-(1-methyl-[3]piperidylester),hydrochloride |
| (1-METHYL-PIPERIDIN-3-YL) N,N-DIPHENYLCARBAMATE |
| Diphenyl-carbamidsaeure-(1-methyl-[3]piperidylester),Hydrochlorid |
| Carbamic acid,diphenyl-,1-methyl-3-piperidyl ester,hydrochloride (7CI,8CI) |