N-bis(4-methylphenoxy)phosphoryl-5-nitro-pyridin-2-amine structure
|
Common Name | N-bis(4-methylphenoxy)phosphoryl-5-nitro-pyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 3246-48-8 | Molecular Weight | 399.33700 | |
| Density | 1.372g/cm3 | Boiling Point | 544.4ºC at 760 mmHg | |
| Molecular Formula | C19H18N3O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283ºC | |
| Name | N-bis(4-methylphenoxy)phosphoryl-5-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 544.4ºC at 760 mmHg |
| Molecular Formula | C19H18N3O5P |
| Molecular Weight | 399.33700 |
| Flash Point | 283ºC |
| Exact Mass | 399.09800 |
| PSA | 116.08000 |
| LogP | 5.88080 |
| Index of Refraction | 1.64 |
| InChIKey | SKPHKNYHLJTWMP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OP(=O)(Nc2ccc([N+](=O)[O-])cn2)Oc2ccc(C)cc2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2880c17 |