N-bis(2-methylphenoxy)phosphoryl-5-chloro-pyridin-2-amine structure
|
Common Name | N-bis(2-methylphenoxy)phosphoryl-5-chloro-pyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 3246-53-5 | Molecular Weight | 388.78500 | |
| Density | 1.335g/cm3 | Boiling Point | 498.7ºC at 760 mmHg | |
| Molecular Formula | C19H18ClN2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4ºC | |
| Name | N-bis(2-methylphenoxy)phosphoryl-5-chloropyridin-2-amine |
|---|
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 498.7ºC at 760 mmHg |
| Molecular Formula | C19H18ClN2O3P |
| Molecular Weight | 388.78500 |
| Flash Point | 255.4ºC |
| Exact Mass | 388.07400 |
| PSA | 70.26000 |
| LogP | 6.10280 |
| Index of Refraction | 1.627 |
| InChIKey | UKRFOVJUJXZGDM-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OP(=O)(Nc1ccc(Cl)cn1)Oc1ccccc1C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |