2-methylpropyl naphthalene-1-carboxylate
2-methylpropyl naphthalene-1-carboxylate structure
|
Common Name | 2-methylpropyl naphthalene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 32461-86-2 | Molecular Weight | 228.28600 | |
| Density | 1.08g/cm3 | Boiling Point | 341.2ºC at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methylpropyl naphthalene-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 341.2ºC at 760 mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 150.2ºC |
| Exact Mass | 228.11500 |
| PSA | 26.30000 |
| LogP | 3.65260 |
| Index of Refraction | 1.573 |
| InChIKey | ZMNJWSHRBLQOSM-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1cccc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-methylpropyl ... CAS#:32461-86-2 |
| Literature: Miyagi, Kotaro; Moriyama, Katsuhiko; Togo, Hideo European Journal of Organic Chemistry, 2013 , # 26 p. 5886 - 5892 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-methylpropyl naphthalene-1-carboxylate? |
| A: Polar surface area (PSA) of 2-methylpropyl naphthalene-1-carboxylate is 26.30000. |
| Q: What is the boiling point of 2-methylpropyl naphthalene-1-carboxylate? |
| A: Boiling point of 2-methylpropyl naphthalene-1-carboxylate is 341.2ºC at 760 mmHg. |
| Q: What is the CAS number of 2-methylpropyl naphthalene-1-carboxylate? |
| A: CAS number of 2-methylpropyl naphthalene-1-carboxylate is 32461-86-2. |
| Q: What is the SMILES notation of 2-methylpropyl naphthalene-1-carboxylate? |
| A: SMILES notation of 2-methylpropyl naphthalene-1-carboxylate is CC(C)COC(=O)c1cccc2ccccc12. |
| Q: What is the LogP of 2-methylpropyl naphthalene-1-carboxylate? |
| A: LogP of 2-methylpropyl naphthalene-1-carboxylate is 3.65260. |
| Q: What is the InChIKey of 2-methylpropyl naphthalene-1-carboxylate? |
| A: InChIKey of 2-methylpropyl naphthalene-1-carboxylate is ZMNJWSHRBLQOSM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 32461-86-2? |
| A: Chinese name of 32461-86-2 is 32461-86-2. |
| Q: What is the English name of 2-methylpropyl naphthalene-1-carboxylate? |
| A: The English name of 2-methylpropyl naphthalene-1-carboxylate is 2-methylpropyl naphthalene-1-carboxylate. |
| Q: What is the molecular formula of 2-methylpropyl naphthalene-1-carboxylate? |
| A: Molecular formula of 2-methylpropyl naphthalene-1-carboxylate is C15H16O2. |
| Q: What is the molecular weight of 2-methylpropyl naphthalene-1-carboxylate? |
| A: Molecular weight of 2-methylpropyl naphthalene-1-carboxylate is 228.28600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |