(S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride
Modify Date: 2025-09-09 18:41:12
(S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride structure
|
Common Name | (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 324795-98-4 | Molecular Weight | 281.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18Cl2N2O2 |
|---|---|
| Molecular Weight | 281.18 |
| InChIKey | KLIUMDCNWMFBIN-XRIOVQLTSA-N |
| SMILES | COC(=O)C(N)CNCc1ccccc1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride? |
| A: InChIKey of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride is KLIUMDCNWMFBIN-XRIOVQLTSA-N. |
| Q: What is the molecular formula of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride? |
| A: Molecular formula of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride is C11H18Cl2N2O2. |
| Q: What is the Chinese name of 324795-98-4? |
| A: Chinese name of 324795-98-4 is 324795-98-4. |
| Q: What is the English name of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride? |
| A: The English name of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride is (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride. |
| Q: What is the molecular weight of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride? |
| A: Molecular weight of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride is 281.18. |
| Q: What is the CAS number of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride? |
| A: CAS number of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride is 324795-98-4. |
| Q: What is the SMILES notation of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride? |
| A: SMILES notation of (S)-Methyl 2-amino-3-(benzylamino)propanoate dihydrochloride is COC(=O)C(N)CNCc1ccccc1.Cl.Cl. |