2,3-Diketoadipic acid diethyl ester structure
|
Common Name | 2,3-Diketoadipic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3249-69-2 | Molecular Weight | 230.21500 | |
| Density | 1.181g/cm3 | Boiling Point | 299.4ºC at 760 mmHg | |
| Molecular Formula | C10H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.4ºC | |
| Name | 2,3-Diketoadipic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 299.4ºC at 760 mmHg |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.21500 |
| Flash Point | 128.4ºC |
| Exact Mass | 230.07900 |
| PSA | 86.74000 |
| LogP | 0.03100 |
| Index of Refraction | 1.446 |
| InChIKey | RMJADBFOZDJRAI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C(=O)CC(=O)OCC |
| HS Code | 2918300090 |
|---|
|
~75%
2,3-Diketoadipi... CAS#:3249-69-2 |
| Literature: Waly; Said; Ayyad Polish Journal of Chemistry, 1996 , vol. 70, # 3 p. 296 - 301 |
|
~%
2,3-Diketoadipi... CAS#:3249-69-2 |
| Literature: Fittig; Daimler; Keller Justus Liebigs Annalen der Chemie, 1888 , vol. 249, p. 198 |
|
~%
2,3-Diketoadipi... CAS#:3249-69-2 |
| Literature: Smrt et al. Collection of Czechoslovak Chemical Communications, 1955 , vol. 20, p. 285,289 |
|
~%
2,3-Diketoadipi... CAS#:3249-69-2 |
| Literature: Stachel,H.-D. Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft, 1962 , vol. 295, # 10 p. 735 - 744 |
|
~%
2,3-Diketoadipi... CAS#:3249-69-2 |
| Literature: Smrt et al. Collection of Czechoslovak Chemical Communications, 1955 , vol. 20, p. 285,289 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3,4-dioxo-3,4-dihydro-[2]naphthoic acid methyl ester |
| 3-carbomethoxy-1,2-naphthoquinone |
| Naphthochinon-(1.2)-carbonsaeure-(3)-methylester |
| 3,4-Dioxo-adipinsaeure-diaethylester |
| 3,4-dioxo-adipic acid diethyl ester |
| 2-Naphthalenecarboxylic acid,3,4-dihydro-3,4-dioxo-,methyl ester |
| 3,4-Dioxo-3,4-dihydro-[2]naphthoesaeure-methylester |
| Ketipinsaeure-diaethylester |
| 3,4-dioxo-hexanedicarboxylic acid diethyl ester |
| 3-Methoxycarbonyl-1,2-naphthochinon |