2-methylbut-3-yn-2-yl N-(4-chlorophenyl)carbamate structure
|
Common Name | 2-methylbut-3-yn-2-yl N-(4-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 32496-81-4 | Molecular Weight | 237.68200 | |
| Density | 1.246g/cm3 | Boiling Point | 283.3ºC at 760 mmHg | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.1ºC | |
| Name | 3-(4-chloro-phenylcarbamoyloxy)-3-methyl-but-1-yne |
|---|
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 283.3ºC at 760 mmHg |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.68200 |
| Flash Point | 125.1ºC |
| Exact Mass | 237.05600 |
| PSA | 38.33000 |
| LogP | 3.37330 |
| Index of Refraction | 1.58 |
| InChIKey | JDCYLDGYWWSQPS-UHFFFAOYSA-N |
| SMILES | C#CC(C)(C)OC(=O)Nc1ccc(Cl)cc1 |
|
~%
2-methylbut-3-y... CAS#:32496-81-4 |
| Literature: Francis,T.; Thorne,M.P. Canadian Journal of Chemistry, 1976 , vol. 54, p. 24 - 30 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |