N-(carbamoyl-methylsulfanyl-methyl)-4-methoxy-benzamide structure
|
Common Name | N-(carbamoyl-methylsulfanyl-methyl)-4-methoxy-benzamide | ||
|---|---|---|---|---|
| CAS Number | 32496-96-1 | Molecular Weight | 254.30500 | |
| Density | 1.259g/cm3 | Boiling Point | 481.8ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.2ºC | |
| Name | N-(2-amino-1-methylsulfanyl-2-oxoethyl)-4-methoxybenzamide |
|---|
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 481.8ºC at 760 mmHg |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.30500 |
| Flash Point | 245.2ºC |
| Exact Mass | 254.07300 |
| PSA | 106.72000 |
| LogP | 1.69060 |
| Index of Refraction | 1.581 |
| InChIKey | YHHCJXBJPBDNOQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NC(SC)C(N)=O)cc1 |
|
~%
N-(carbamoyl-me... CAS#:32496-96-1 |
| Literature: Shah; Lam; Ketcham Journal of medicinal chemistry, 1971 , vol. 14, # 5 p. 456 - 458 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |