N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline
Modify Date: 2026-08-05 18:05:38
N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline structure
|
Common Name | N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline | ||
|---|---|---|---|---|
| CAS Number | 32503-44-9 | Molecular Weight | 341.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClF3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11ClF3N3O4 |
|---|---|
| Molecular Weight | 341.67 |
| InChIKey | CVWPYQNESAJEJT-UHFFFAOYSA-N |
| SMILES | CCC(C)Nc1c(C(F)(F)F)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline? |
| A: SMILES notation of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline is CCC(C)Nc1c(C(F)(F)F)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-]. |
| Q: What is the molecular formula of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline? |
| A: Molecular formula of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline is C11H11ClF3N3O4. |
| Q: What is the CAS number of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline? |
| A: CAS number of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline is 32503-44-9. |
| Q: What is the English name of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline? |
| A: The English name of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline is N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline. |
| Q: What is the Chinese name of 32503-44-9? |
| A: Chinese name of 32503-44-9 is 32503-44-9. |
| Q: What is the molecular weight of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline? |
| A: Molecular weight of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline is 341.67. |
| Q: What is the InChIKey of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline? |
| A: InChIKey of N-sec-butyl-3-chloro-2,4-dinitro-6-trifluoromethylaniline is CVWPYQNESAJEJT-UHFFFAOYSA-N. |