N-(5-Acetyl-4-methyl-1,3-thiazol-2-yl)-2-chloroacetamide structure
|
Common Name | N-(5-Acetyl-4-methyl-1,3-thiazol-2-yl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 32519-70-3 | Molecular Weight | 232.68700 | |
| Density | 1.415g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H9ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-Acetyl-4-methyl-1,3-thiazol-2-yl)-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Molecular Formula | C8H9ClN2O2S |
| Molecular Weight | 232.68700 |
| Exact Mass | 232.00700 |
| PSA | 90.79000 |
| LogP | 2.48090 |
| Index of Refraction | 1.606 |
| InChIKey | HBVMMWIEJRQDOO-UHFFFAOYSA-N |
| SMILES | CC(=O)c1sc(NC(=O)CCl)nc1C |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Chloracetylamino-4-methyl-5-acetyl-thiazol |
| 1-[2-(2-chloro-acetylamino)-4-methyl-thiazol-5-yl]-ethanone |