1-Methyl-3-phenyl-4-(1'-methyl)propylthio-5-aminopyrazole structure
|
Common Name | 1-Methyl-3-phenyl-4-(1'-methyl)propylthio-5-aminopyrazole | ||
|---|---|---|---|---|
| CAS Number | 32527-99-4 | Molecular Weight | 261.38600 | |
| Density | 1.16g/cm3 | Boiling Point | 416.5ºC at 760mmHg | |
| Molecular Formula | C14H19N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | 4-butan-2-ylsulfanyl-2-methyl-5-phenylpyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760mmHg |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.38600 |
| Flash Point | 205.7ºC |
| Exact Mass | 261.13000 |
| PSA | 69.14000 |
| LogP | 4.14110 |
| Index of Refraction | 1.61 |
| InChIKey | WQECKYWGHPFPAU-UHFFFAOYSA-N |
| SMILES | CCC(C)Sc1c(-c2ccccc2)nn(C)c1N |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Aatp-III |
| 4-sec-butylsulfanyl-2-methyl-5-phenyl-2H-pyrazol-3-ylamine |