4-(2-benzo[1,3]dioxol-5-ylethenyl)pyridine structure
|
Common Name | 4-(2-benzo[1,3]dioxol-5-ylethenyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 32555-74-1 | Molecular Weight | 225.24300 | |
| Density | 1.272g/cm3 | Boiling Point | 376.4ºC at 760 mmHg | |
| Molecular Formula | C14H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137ºC | |
| Name | 4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 376.4ºC at 760 mmHg |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24300 |
| Flash Point | 137ºC |
| Exact Mass | 225.07900 |
| PSA | 31.35000 |
| LogP | 2.98070 |
| Index of Refraction | 1.693 |
| InChIKey | YOBLRHFAUWAOPW-OWOJBTEDSA-N |
| SMILES | C(=Cc1ccc2c(c1)OCO2)c1ccncc1 |
|
~%
4-(2-benzo[1,3]... CAS#:32555-74-1 |
| Literature: Harrowven, David C.; Sutton, Benjamin J.; Coulton, Steven Organic and Biomolecular Chemistry, 2003 , vol. 1, # 22 p. 4047 - 4057 |
|
~%
4-(2-benzo[1,3]... CAS#:32555-74-1 |
| Literature: Bramsch Chemische Berichte, 1909 , vol. 42, p. 1194 |
|
~%
4-(2-benzo[1,3]... CAS#:32555-74-1 |
| Literature: Harrowven, David C.; Sutton, Benjamin J.; Coulton, Steven Organic and Biomolecular Chemistry, 2003 , vol. 1, # 22 p. 4047 - 4057 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 4-(3',4'-Methylendioxystyryl)-pyridin |
| 4-(2-Benzo[1,3]dioxol-5-yl-vinyl)-pyridin |
| 4-(trans-2-benzo[1,3]dioxol-5-yl-vinyl)-pyridine |
| 4-(2-benzo[1,3]dioxol-5-yl-vinyl)-pyridine |
| (E)-4-[2-(1,3-benzodioxol-5-yl)-1-ethenyl]pyridine |