ethyl p-isopropylcinnamate structure
|
Common Name | ethyl p-isopropylcinnamate | ||
|---|---|---|---|---|
| CAS Number | 32580-69-1 | Molecular Weight | 218.29200 | |
| Density | 1.006g/cm3 | Boiling Point | 312.9ºC at 760mmHg | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | Ethyl 3-(4-isopropylphenyl)acrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.006g/cm3 |
|---|---|
| Boiling Point | 312.9ºC at 760mmHg |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29200 |
| Flash Point | 165ºC |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 3.38630 |
| Index of Refraction | 1.533 |
| InChIKey | XCRHYAQWBYDRGV-JXMROGBWSA-N |
| SMILES | CCOC(=O)C=Cc1ccc(C(C)C)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
ethyl p-isoprop... CAS#:32580-69-1 |
| Literature: Helvetica Chimica Acta, , vol. 5, p. 934 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Isopropyl-zimtsaeure-aethylester |
| 4-Isopropyl-zimtsaeureethylester |
| 3-[4-(1-Methylethyl)phenyl]propenoic acid ethyl ester |
| ethyl p-isopropylcinnamate |
| 4-isopropyl-cinnamic acid ethyl ester |