2-(5-chloropyridin-1-yl)-1-(4-fluorophenyl)ethanone structure
|
Common Name | 2-(5-chloropyridin-1-yl)-1-(4-fluorophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 326-01-2 | Molecular Weight | 330.58000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chloropyridin-1-ium-1-yl)-1-(4-fluorophenyl)ethanone,bromide |
|---|
| Molecular Formula | C13H10BrClFNO |
|---|---|
| Molecular Weight | 330.58000 |
| Exact Mass | 328.96200 |
| PSA | 20.95000 |
| InChIKey | SCSRPDVHKPHMIA-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1cccc(Cl)c1)c1ccc(F)cc1.[Br-] |
|
~%
2-(5-chloropyri... CAS#:326-01-2 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |