2-(3-chloropyrazin-1-yl)-1-(4-fluorophenyl)ethanone
Modify Date: 2024-04-02 17:55:26
2-(3-chloropyrazin-1-yl)-1-(4-fluorophenyl)ethanone structure
|
Common Name | 2-(3-chloropyrazin-1-yl)-1-(4-fluorophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 326-02-3 | Molecular Weight | 331.56800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrClFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chloropyrazin-1-ium-1-yl)-1-(4-fluorophenyl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9BrClFN2O |
|---|---|
| Molecular Weight | 331.56800 |
| Exact Mass | 329.95700 |
| PSA | 33.84000 |
| InChIKey | QPIQLRZSXQVLDJ-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccnc(Cl)c1)c1ccc(F)cc1.[Br-] |
|
~%
2-(3-chloropyra... CAS#:326-02-3 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3960 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Chlor-1-(4-fluor-phenacyl)-pyrazinium,Bromid |
| 3-chloro-1-(4-fluoro-phenacyl)-pyrazinium,bromide |