1,3-Hexanedione,1-(5-bromo-2-thienyl)-4,4,5,5,6,6,6-heptafluoro- structure
|
Common Name | 1,3-Hexanedione,1-(5-bromo-2-thienyl)-4,4,5,5,6,6,6-heptafluoro- | ||
|---|---|---|---|---|
| CAS Number | 326-07-8 | Molecular Weight | 401.09500 | |
| Density | 1.758g/cm3 | Boiling Point | 326ºC at 760mmHg | |
| Molecular Formula | C10H4BrF7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
| Name | 1-(5-bromothiophen-2-yl)-4,4,5,5,6,6,6-heptafluorohexane-1,3-dione |
|---|
| Density | 1.758g/cm3 |
|---|---|
| Boiling Point | 326ºC at 760mmHg |
| Molecular Formula | C10H4BrF7O2S |
| Molecular Weight | 401.09500 |
| Flash Point | 151ºC |
| Exact Mass | 399.90000 |
| PSA | 62.38000 |
| LogP | 4.48540 |
| Index of Refraction | 1.455 |
| InChIKey | GMRONWZVBITWAM-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(Br)s1 |
|
~%
1,3-Hexanedione... CAS#:326-07-8 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |