1-(5-bromothiophen-2-yl)-4,4,4-trifluoro-butane-1,3-dione structure
|
Common Name | 1-(5-bromothiophen-2-yl)-4,4,4-trifluoro-butane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 326-71-6 | Molecular Weight | 301.08000 | |
| Density | 1.738g/cm3 | Boiling Point | 326ºC at 760 mmHg | |
| Molecular Formula | C8H4BrF3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.9ºC | |
| Name | 1-(5-bromothiophen-2-yl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.738g/cm3 |
|---|---|
| Boiling Point | 326ºC at 760 mmHg |
| Molecular Formula | C8H4BrF3O2S |
| Molecular Weight | 301.08000 |
| Flash Point | 150.9ºC |
| Exact Mass | 299.90700 |
| PSA | 62.38000 |
| LogP | 3.21480 |
| Index of Refraction | 1.513 |
| InChIKey | WARMYUHRJCPHQC-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(Br)s1 |
|
~65%
1-(5-bromothiop... CAS#:326-71-6 |
| Literature: Freund, Christelle; Porzio, William; Giovanella, Umberto; Vignali, Francesco; Pasini, Mariacecilia; Destri, Silvia; Mech, Agnieszka; Di Pietro, Sebastiano; Di Bari, Lorenzo; Mineo, Placido Inorganic Chemistry, 2011 , vol. 50, # 12 p. 5417 - 5429 |
|
~%
1-(5-bromothiop... CAS#:326-71-6 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(5-Brom-[2]thienyl)-4,4,4-trifluor-butan-1,3-dion |
| 5-bromo-3,4-dihydronaphthalen-2(1H)-one |
| 5-Bromo-2-oxo-1,2,3,4-tetrahydronaphthalene |
| 5-Bromo-2-tetralone |
| 5-bromothenoyltrifluoroacetone |
| 1-(5-bromo-[2]thienyl)-4,4,4-trifluoro-butane-1,3-dione |
| 2(1H)-Naphthalenone,5-bromo-3,4-dihydro |
| 5-bromo-2-thienoyl-trifluoroacetone |