(E)-3-(2,4,5-Trichlorophenyl)acrylic acid
Modify Date: 2026-07-17 16:24:47
(E)-3-(2,4,5-Trichlorophenyl)acrylic acid structure
|
Common Name | (E)-3-(2,4,5-Trichlorophenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 32609-05-5 | Molecular Weight | 251.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-3-(2,4,5-Trichlorophenyl)acrylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5Cl3O2 |
|---|---|
| Molecular Weight | 251.5 |
| InChIKey | JBFRKEOQJVZICK-OWOJBTEDSA-N |
| SMILES | O=C(O)C=Cc1cc(Cl)c(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid? |
| A: SMILES notation of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid is O=C(O)C=Cc1cc(Cl)c(Cl)cc1Cl. |
| Q: What is the Chinese name of 32609-05-5? |
| A: Chinese name of 32609-05-5 is 32609-05-5. |
| Q: What is the CAS number of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid? |
| A: CAS number of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid is 32609-05-5. |
| Q: What is the molecular weight of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid? |
| A: Molecular weight of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid is 251.5. |
| Q: What is the molecular formula of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid? |
| A: Molecular formula of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid is C9H5Cl3O2. |
| Q: What is the InChIKey of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid? |
| A: InChIKey of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid is JBFRKEOQJVZICK-OWOJBTEDSA-N. |
| Q: What is the English name of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid? |
| A: The English name of (E)-3-(2,4,5-Trichlorophenyl)acrylic acid is (E)-3-(2,4,5-Trichlorophenyl)acrylic acid. |