3(2H)-Benzofuranone,7-chloro-4,6-dimethoxy- structure
|
Common Name | 3(2H)-Benzofuranone,7-chloro-4,6-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 3261-06-1 | Molecular Weight | 228.62900 | |
| Density | 1.377g/cm3 | Boiling Point | 390.9ºC at 760mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.5ºC | |
| Name | 7-chloro-4,6-dimethoxy-1-benzofuran-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 390.9ºC at 760mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 176.5ºC |
| Exact Mass | 228.01900 |
| PSA | 44.76000 |
| LogP | 1.93230 |
| Index of Refraction | 1.561 |
| InChIKey | LXAQGDPMKKHFKF-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1Cl)OCC2=O |
|
~94%
3(2H)-Benzofura... CAS#:3261-06-1 |
| Literature: Tomozane; Takeuchi; Choshi; Kishida; Yamato Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 4 p. 925 - 929 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-chloro-4,6-dimethoxy-1-benzofuran-3(2h)-one |
| 7-chloro-4,6-dimethoxy-2H-benzofuran-3-one |
| 7-chloro-4,6-dimethoxy-3(2H)-benzofuranone |
| 7-chloro-4,6-dimethoxy-2,3-dihydrobenzo<b>furan-3-one |
| 7-Chlor-4,6-dimethoxy-cumaranon |