3-[4-(2-carboxyanilino)phenyl]adamantane-1-carboxylic acid structure
|
Common Name | 3-[4-(2-carboxyanilino)phenyl]adamantane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 32615-25-1 | Molecular Weight | 391.46000 | |
| Density | 1.378g/cm3 | Boiling Point | 596.9ºC at 760 mmHg | |
| Molecular Formula | C24H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.8ºC | |
| Name | 3-[4-(2-carboxyanilino)phenyl]adamantane-1-carboxylic acid |
|---|
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 596.9ºC at 760 mmHg |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.46000 |
| Flash Point | 314.8ºC |
| Exact Mass | 391.17800 |
| PSA | 86.63000 |
| LogP | 5.12400 |
| Index of Refraction | 1.692 |
| InChIKey | BIUBFJVDJRRNKO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1ccc(C23CC4CC(CC(C(=O)O)(C4)C2)C3)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |