N-(2,3,4,5-tetrachloro-6-methoxy-phenyl)acetamide structure
|
Common Name | N-(2,3,4,5-tetrachloro-6-methoxy-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 32617-96-2 | Molecular Weight | 302.96900 | |
| Density | 1.559g/cm3 | Boiling Point | 397.2ºC at 760 mmHg | |
| Molecular Formula | C9H7Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | N-(2,3,4,5-tetrachloro-6-methoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 397.2ºC at 760 mmHg |
| Molecular Formula | C9H7Cl4NO2 |
| Molecular Weight | 302.96900 |
| Flash Point | 194ºC |
| Exact Mass | 300.92300 |
| PSA | 38.33000 |
| LogP | 4.34020 |
| Index of Refraction | 1.603 |
| InChIKey | OTXMCMYNIBGUJB-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)c(Cl)c(Cl)c(Cl)c1NC(C)=O |
| HS Code | 2924299090 |
|---|
|
~84%
N-(2,3,4,5-tetr... CAS#:32617-96-2 |
| Literature: Kajigaeshi; Shinmasu; Fujisaki; Kakinami Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 3 p. 941 - 943 |
|
~%
N-(2,3,4,5-tetr... CAS#:32617-96-2 |
| Literature: Bures; Havlinova C.csl.lekarn., vol. 9, p. 101,129 Chem. Zentralbl., 1929 , vol. 100, # II p. 1403 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| acetic acid-(2,3,4,5-tetrachloro-6-methoxy-anilide) |
| 3.4.5.6-Tetrachlor-2-acetamino-anisol |
| N-(2,3,4,5-TETRACHLORO-6-METHOXY-PHENYL)ACETAMIDE |
| 3,4,5,6-tetrachloro-2-methoxyacetanilide |
| Essigsaeure-(2,3,4,5-tetrachlor-6-methoxy-anilid) |