Diethylthiophosphinic acid O-[4-(dimethylamino)sulfonylphenyl] ester structure
|
Common Name | Diethylthiophosphinic acid O-[4-(dimethylamino)sulfonylphenyl] ester | ||
|---|---|---|---|---|
| CAS Number | 3263-82-9 | Molecular Weight | 321.39600 | |
| Density | 1.233g/cm3 | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C12H20NO3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5ºC | |
| Name | 4-diethylphosphinothioyloxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760 mmHg |
| Molecular Formula | C12H20NO3PS2 |
| Molecular Weight | 321.39600 |
| Flash Point | 206.5ºC |
| Exact Mass | 321.06200 |
| PSA | 96.89000 |
| LogP | 4.48140 |
| Index of Refraction | 1.547 |
| InChIKey | QSRCDJKIVXEKTI-UHFFFAOYSA-N |
| SMILES | CCP(=S)(CC)Oc1ccc(S(=O)(=O)N(C)C)cc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Phosphinothioic acid,diethyl-,O-ester with N,N-dimethyl-p-hydroxybenzenesulfonamide |
| 4-Diaethylthiophosphinoyloxy-benzolsulfonsaeure-dimethylamid |