1-bromo-4-(bromomethyl)-2-nitrobenzene structure
|
Common Name | 1-bromo-4-(bromomethyl)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 326595-66-8 | Molecular Weight | 294.92800 | |
| Density | 2.006g/cm3 | Boiling Point | 325.8ºC at 760mmHg | |
| Molecular Formula | C7H5Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.8ºC | |
| Name | 1-bromo-4-(bromomethyl)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.006g/cm3 |
|---|---|
| Boiling Point | 325.8ºC at 760mmHg |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.92800 |
| Flash Point | 150.8ºC |
| Exact Mass | 292.86900 |
| PSA | 45.82000 |
| LogP | 3.77540 |
| Index of Refraction | 1.643 |
| InChIKey | PXAIZWVEYHNBLL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CBr)ccc1Br |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1-bromo-4-(bromomethyl)-2-nitro |
| 4-Bromo-3-nitrobenzyl bromide |
| 1-bromo-4-bromomethyl-2-nitro-benzene |
| 4-bromo-3-nitro-1-bromomethylbenzene |
| 2-bromo-5-bromomethylnitrobenzene |
| 2-bromo-5-(bromomethyl)-1-nitrobenzene |