propyl 3-dipropoxyphosphanyloxy-2,2,4-trimethyl-pent-3-enoate structure
|
Common Name | propyl 3-dipropoxyphosphanyloxy-2,2,4-trimethyl-pent-3-enoate | ||
|---|---|---|---|---|
| CAS Number | 32674-66-1 | Molecular Weight | 348.41500 | |
| Density | N/A | Boiling Point | 380.9ºC at 760 mmHg | |
| Molecular Formula | C17H33O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2ºC | |
| Name | propyl 3-dipropoxyphosphanyloxy-2,2,4-trimethylpent-3-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 380.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H33O5P |
| Molecular Weight | 348.41500 |
| Flash Point | 184.2ºC |
| Exact Mass | 348.20700 |
| PSA | 67.58000 |
| LogP | 5.35640 |
| InChIKey | MBMLVHGZAPNDPD-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C(C)(C)C(OP(OCCC)OCCC)=C(C)C |
| HS Code | 2918990090 |
|---|
|
~%
propyl 3-diprop... CAS#:32674-66-1 |
| Literature: Bentrude,W.G. et al. Journal of Organic Chemistry, 1972 , vol. 37, # 4 p. 631 - 642 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Propyl 3-((dipropoxyphosphino)oxy)-2,2,4-trimethyl-3-pentenoate |