1-Methyl-1-propylpyrrolidinium dicyanamide
Modify Date: 2025-09-09 14:20:40
1-Methyl-1-propylpyrrolidinium dicyanamide structure
|
Common Name | 1-Methyl-1-propylpyrrolidinium dicyanamide | ||
|---|---|---|---|---|
| CAS Number | 327022-60-6 | Molecular Weight | 194.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Methyl-1-propylpyrrolidinium dicyanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N4 |
|---|---|
| Molecular Weight | 194.28 |
| InChIKey | SORLFCHAANOJJA-UHFFFAOYSA-N |
| SMILES | CCC[N+]1(C)CCCC1.N#CN=C=[N-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-Methyl-1-propylpyrrolidinium dicyanamide? |
| A: CAS number of 1-Methyl-1-propylpyrrolidinium dicyanamide is 327022-60-6. |
| Q: What is the SMILES notation of 1-Methyl-1-propylpyrrolidinium dicyanamide? |
| A: SMILES notation of 1-Methyl-1-propylpyrrolidinium dicyanamide is CCC[N+]1(C)CCCC1.N#CN=C=[N-]. |
| Q: What is the InChIKey of 1-Methyl-1-propylpyrrolidinium dicyanamide? |
| A: InChIKey of 1-Methyl-1-propylpyrrolidinium dicyanamide is SORLFCHAANOJJA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Methyl-1-propylpyrrolidinium dicyanamide? |
| A: Molecular weight of 1-Methyl-1-propylpyrrolidinium dicyanamide is 194.28. |
| Q: What is the English name of 1-Methyl-1-propylpyrrolidinium dicyanamide? |
| A: The English name of 1-Methyl-1-propylpyrrolidinium dicyanamide is 1-Methyl-1-propylpyrrolidinium dicyanamide. |
| Q: What is the molecular formula of 1-Methyl-1-propylpyrrolidinium dicyanamide? |
| A: Molecular formula of 1-Methyl-1-propylpyrrolidinium dicyanamide is C10H18N4. |
| Q: What is the Chinese name of 327022-60-6? |
| A: Chinese name of 327022-60-6 is 327022-60-6. |