Acetic acid,2-(6-chloro-3,4-dihydro-3-oxo-2H-1,4-benzothiazin-2-ylidene)-, methyl ester structure
|
Common Name | Acetic acid,2-(6-chloro-3,4-dihydro-3-oxo-2H-1,4-benzothiazin-2-ylidene)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 32723-06-1 | Molecular Weight | 269.70400 | |
| Density | 1.52g/cm3 | Boiling Point | 454.6ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | methyl (2Z)-2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-ylidene)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760 mmHg |
| Molecular Formula | C11H8ClNO3S |
| Molecular Weight | 269.70400 |
| Flash Point | 228.8ºC |
| Exact Mass | 268.99100 |
| PSA | 87.40000 |
| LogP | 1.47760 |
| Index of Refraction | 1.687 |
| InChIKey | WTPZLJCHGMJGHC-UITAMQMPSA-N |
| SMILES | COC(=O)C=C1Sc2ccc(Cl)cc2NC1=O |
|
~%
Acetic acid,2-(... CAS#:32723-06-1 |
| Literature: Heindel; Reid; Willis Journal of medicinal chemistry, 1971 , vol. 14, # 5 p. 453 - 453 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Chlor-2-methoxycarbonylmethylen-2H-benzo<1,4>thiazin-3-on |