Heliosupine structure
|
Common Name | Heliosupine | ||
|---|---|---|---|---|
| CAS Number | 32728-78-2 | Molecular Weight | 397.46300 | |
| Density | 1.26g/cm3 | Boiling Point | 535.7ºC at 760mmHg | |
| Molecular Formula | C20H31NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.8ºC | |
Use of HeliosupineHeliosupine is a pyrrolizidine alkaloid. Heliosupine is an acetylcholinesterase (AChE) inhibitor, with an IC50 0.57 mM. Heliosupine exhibits deterrent effects against generalist herbivores[1][2]. |
| Name | heliosupine |
|---|---|
| Synonym | More Synonyms |
| Description | Heliosupine is a pyrrolizidine alkaloid. Heliosupine is an acetylcholinesterase (AChE) inhibitor, with an IC50 0.57 mM. Heliosupine exhibits deterrent effects against generalist herbivores[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.57 mM (AChE)[1] |
| In Vivo | Heliosupine prevents feeding by the polyphagous larvae of Spodoptera exigua[2]. |
| References |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 535.7ºC at 760mmHg |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.46300 |
| Flash Point | 277.8ºC |
| Exact Mass | 397.21000 |
| PSA | 116.53000 |
| LogP | 0.24260 |
| Index of Refraction | 1.565 |
| InChIKey | HRSGCYGUWHGOPY-UKLMUADPSA-N |
| SMILES | CC=C(C)C(=O)OC1CCN2CC=C(COC(=O)C(O)(C(C)O)C(C)(C)O)C12 |
| Cynoglossofine |
| 7-Angelyl-9-echimidinylheliotridine |
| HELIOSUPINE |
| Heliosupin |
| Cynoglossophine |
| [(7S,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2,3-dihydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
| Cynoglossofin |