Benzenamine,4,4'-oxybis[2-nitro- structure
|
Common Name | Benzenamine,4,4'-oxybis[2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 3273-78-7 | Molecular Weight | 290.23200 | |
| Density | 1.541g/cm3 | Boiling Point | 510.7ºC at 760mmHg | |
| Molecular Formula | C12H10N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.7ºC | |
| Name | 4-(4-amino-3-nitrophenoxy)-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.541g/cm3 |
|---|---|
| Boiling Point | 510.7ºC at 760mmHg |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.23200 |
| Flash Point | 262.7ºC |
| Exact Mass | 290.06500 |
| PSA | 152.91000 |
| LogP | 4.66850 |
| Index of Refraction | 1.718 |
| InChIKey | UPUDSFHDZIXLGD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(N)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-dinitro-4,4'-diaminodiphenyl ether |
| Bis-<4-amino-3-nitro-phenyl>-aether |
| 4,4'-diamino-3,3'-dinitrodiphenylether |