ethyl 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylate structure
|
Common Name | ethyl 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 3274-67-7 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3,5-dimethyl-4-phenyl-1H-pyrrole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 42.09000 |
| LogP | 3.47520 |
| InChIKey | XYPRHOAISYCPFQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(C)c(-c2ccccc2)c1C |
| HS Code | 2933990090 |
|---|
|
~96%
ethyl 3,5-dimet... CAS#:3274-67-7 |
| Literature: Chang, C. K.; Bag, Nilkamal Journal of Organic Chemistry, 1995 , vol. 60, # 21 p. 7030 - 7032 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Ethoxycarbonyl-3,5-dimethyl-4-phenyl-pyrrol |
| 3,5-dimethyl-4-phenyl-pyrrole-2-carboxylic acid ethyl ester |
| 1H-Pyrrole-2-carboxylic acid,3,5-dimethyl-4-phenyl-,ethyl ester |
| ethyl 3,5-dimethyl-4-phenyl-2-pyrrolecarboxylate |