1-Propanone,1-(4-bromophenyl)-, 2-[1-(4-bromophenyl)propylidene]hydrazone structure
|
Common Name | 1-Propanone,1-(4-bromophenyl)-, 2-[1-(4-bromophenyl)propylidene]hydrazone | ||
|---|---|---|---|---|
| CAS Number | 32770-73-3 | Molecular Weight | 422.15700 | |
| Density | 1.416g/cm3 | Boiling Point | 434.884ºC at 760 mmHg | |
| Molecular Formula | C18H18Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.81ºC | |
| Name | (E)-1-(4-bromophenyl)-N-[(E)-1-(4-bromophenyl)propylideneamino]propan-1-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 434.884ºC at 760 mmHg |
| Molecular Formula | C18H18Br2N2 |
| Molecular Weight | 422.15700 |
| Flash Point | 216.81ºC |
| Exact Mass | 419.98400 |
| PSA | 24.72000 |
| LogP | 6.22500 |
| Index of Refraction | 1.595 |
| InChIKey | HESJEUSORFTBEI-KSTNYAOJSA-N |
| SMILES | CCC(=NN=C(CC)c1ccc(Br)cc1)c1ccc(Br)cc1 |
|
~%
1-Propanone,1-(... CAS#:32770-73-3 |
| Literature: Manih, Rudolf M.; Myrboh, Bekington Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 1 p. 146 - 151 |
|
~%
1-Propanone,1-(... CAS#:32770-73-3 |
| Literature: v. Vargha; Kovacs Chemische Berichte, 1942 , vol. 75, p. 794,802 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Brompropiophenon-azin |