Ethylthiophosphonic acid O-isopropyl O-(2-chloro-4-nitrophenyl) ester structure
|
Common Name | Ethylthiophosphonic acid O-isopropyl O-(2-chloro-4-nitrophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 328-04-1 | Molecular Weight | 323.73300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClNO4PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethanthiophosphonsaeure-[2-chlor-4-nitro-phenylester]-isopropionylester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15ClNO4PS |
|---|---|
| Molecular Weight | 323.73300 |
| Exact Mass | 323.01500 |
| PSA | 106.18000 |
| LogP | 5.55520 |
| InChIKey | QINWTFKFPMRNJP-UHFFFAOYSA-N |
| SMILES | CCP(=S)(Oc1ccc([N+](=O)[O-])cc1Cl)OC(C)C |
| HS Code | 2930909027 |
|---|
| HS Code | 2930909027 |
|---|---|
| Summary | 2930909027 。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| phosphonothioic acid,ethyl-, o-(2-chloro-4-nitrophenyl) o-(1-methylethyl) ester |