2,6-dibromo-4-[(4-nitrophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one structure
|
Common Name | 2,6-dibromo-4-[(4-nitrophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 3281-96-7 | Molecular Weight | 401.01000 | |
| Density | 1.94g/cm3 | Boiling Point | 470.4ºC at 760mmHg | |
| Molecular Formula | C12H7Br2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.3ºC | |
| Name | 2,6-dibromo-4-[(4-nitrophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 470.4ºC at 760mmHg |
| Molecular Formula | C12H7Br2N3O3 |
| Molecular Weight | 401.01000 |
| Flash Point | 238.3ºC |
| Exact Mass | 398.88500 |
| PSA | 87.28000 |
| LogP | 4.09920 |
| Index of Refraction | 1.709 |
| InChIKey | LGSLCBLDMDBWHB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2cc(Br)c(O)c(Br)c2)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
2,6-dibromo-4-[... CAS#:3281-96-7 |
| Literature: Hewitt; Mitchell Journal of the Chemical Society, 1907 , vol. 91, p. 1264 Full Text Show Details Auwers; Rietz Justus Liebigs Annalen der Chemie, 1907 , vol. 356, p. 163 Anm. |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Yurimin |
| Yurimin P 99 |
| 3.5-Dibrom-4'-nitro-4-oxy-azobenzol |
| PP 99 |
| BAB |
| Yurimin 99 |
| 3,5-Dibromo-4-hydroxy-4'-nitroazobenzene |
| P 99 |