1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester
Modify Date: 2026-07-16 15:37:59
1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester structure
|
Common Name | 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3283-89-4 | Molecular Weight | 341.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H19NO2 |
|---|---|
| Molecular Weight | 341.4 |
| InChIKey | MUUYMFLGUFXWNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester? |
| A: CAS number of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester is 3283-89-4. |
| Q: What is the molecular formula of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester? |
| A: Molecular formula of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester is C23H19NO2. |
| Q: What is the molecular weight of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester? |
| A: Molecular weight of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester is 341.4. |
| Q: What is the English name of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester? |
| A: The English name of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester is 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester. |
| Q: What is the SMILES notation of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester? |
| A: SMILES notation of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester is CCOC(=O)c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12. |
| Q: What is the Chinese name of 3283-89-4? |
| A: Chinese name of 3283-89-4 is 3283-89-4. |
| Q: What is the InChIKey of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester? |
| A: InChIKey of 1h-Indole-3-carboxylic acid,1,2-diphenyl-,ethyl ester is MUUYMFLGUFXWNS-UHFFFAOYSA-N. |