Carbonic dichloride, polymer with 4,4-(1-methylethylidene)bis2,6-dibromophenol and 4,4-(1-methylethylidene)bisphenol structure
|
Common Name | Carbonic dichloride, polymer with 4,4-(1-methylethylidene)bis2,6-dibromophenol and 4,4-(1-methylethylidene)bisphenol | ||
|---|---|---|---|---|
| CAS Number | 32844-27-2 | Molecular Weight | 871.07300 | |
| Density | N/A | Boiling Point | 417.9ºC at 760mmHg | |
| Molecular Formula | C31H28Br4Cl2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | carbonyl dichloride,2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 417.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C31H28Br4Cl2O5 |
| Molecular Weight | 871.07300 |
| Exact Mass | 865.80500 |
| PSA | 97.99000 |
| LogP | 11.48140 |
| InChIKey | JIONBBGQQYEZAC-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1.CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.O=C(Cl)Cl |
| Bisphenol A,phosgene,tetrabromobisphenol A polymer |
| tetrabromobisphenol-A-polycarbonate |