2-Bromo-5-chlorosulfonyl-benzoic acid structure
|
Common Name | 2-Bromo-5-chlorosulfonyl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3285-31-2 | Molecular Weight | 299.526 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 411.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4±25.9 °C | |
| Name | 2-bromo-5-chlorosulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.0±35.0 °C at 760 mmHg |
| Molecular Formula | C7H4BrClO4S |
| Molecular Weight | 299.526 |
| Flash Point | 202.4±25.9 °C |
| Exact Mass | 297.870209 |
| PSA | 79.82000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | ZZSQGLFOZUQDAM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(S(=O)(=O)Cl)ccc1Br |
| Storage condition | Store at room temperature, keep dry and cool |
| HS Code | 2916399090 |
|---|
|
~95%
2-Bromo-5-chlor... CAS#:3285-31-2 |
| Literature: Pfizer Limited; Omoto, Kiyoyuki; Owen, Robert McKenzie; Pryde, David Cameron; Watson, Christine Ann Louise; Takeuchi, Mifune Patent: US2014/171435 A1, 2014 ; Location in patent: Page/Page column ; |
|
~%
2-Bromo-5-chlor... CAS#:3285-31-2 |
| Literature: Pfizer Inc. Patent: US3992441 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Bromo-5-(chlorosulfonyl)benzoic acid |
| 2-Bromo-5-chlorosulfonyl-benzoic acid |
| Benzoic acid, 2-bromo-5-(chlorosulfonyl)- |