2,7-dimethylanthracene-9,10-dione structure
|
Common Name | 2,7-dimethylanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 3286-01-9 | Molecular Weight | 236.26500 | |
| Density | 1.179g/cm3 | Boiling Point | 418.2ºC at 760 mmHg | |
| Molecular Formula | C16H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Name | 2,7-dimethylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 418.2ºC at 760 mmHg |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.26500 |
| Flash Point | 156.4ºC |
| Exact Mass | 236.08400 |
| PSA | 34.14000 |
| LogP | 3.07880 |
| Index of Refraction | 1.593 |
| InChIKey | RATJDSXPVPAWJJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)c1cc(C)ccc1C2=O |
| HS Code | 2914690090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Inhibition of recombinant human MAO-A expressed in baculovirus infected BTI insect ce...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL5144885
|
|
Name: Inhibition of recombinant human MAO-B expressed in baculovirus infected BTI insect ce...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL5144886
|
| 2,7-dimethylanthra-9,10-quinone |
| 2,5-DIMETHYLFURAN-D6 |
| 2,7-dimethyl-anthraquinone-9,10 |
| 2,7-dimethyl-anthraquinone |
| 2,7-Dimethyl-9,10-anthrachinon |
| 2,7-dimethyl-9,10-anthraquinone |