1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione
Modify Date: 2025-08-25 17:40:07
1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione structure
|
Common Name | 1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 328925-71-9 | Molecular Weight | 302.75200 | |
| Density | 1.261g/cm3 | Boiling Point | 497.5ºC at 760 mmHg | |
| Molecular Formula | C17H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.7ºC | |
| Name | 1-(4-chlorophenyl)-3-(5-ethyl-2-hydroxyphenyl)propane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 497.5ºC at 760 mmHg |
| Molecular Formula | C17H15ClO3 |
| Molecular Weight | 302.75200 |
| Flash Point | 254.7ºC |
| Exact Mass | 302.07100 |
| PSA | 54.37000 |
| LogP | 4.06370 |
| Index of Refraction | 1.6 |
| InChIKey | MMODSOIJHZFRTG-UHFFFAOYSA-N |
| SMILES | CCc1ccc(O)c(C(=O)CC(=O)c2ccc(Cl)cc2)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(5-Ethyl-2-hydroxyphenyl)-3-(4-chlorophenyl) |
| 1-(5-ethyl-2-hydroxyphenyl)-3-(4-chlorophenyl)-1,3-propanedione |