L-Serine,N-[N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanyl]-, hydrazide (9CI) structure
|
Common Name | L-Serine,N-[N-[(1,1-dimethylethoxy)carbonyl]-L-phenylalanyl]-, hydrazide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 32899-48-2 | Molecular Weight | 366.41200 | |
| Density | 1.233g/cm3 | Boiling Point | 696.9ºC at 760 mmHg | |
| Molecular Formula | C17H26N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 375.3ºC | |
| Name | tert-butyl N-[1-[(1-hydrazinyl-3-hydroxy-1-oxopropan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 696.9ºC at 760 mmHg |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.41200 |
| Flash Point | 375.3ºC |
| Exact Mass | 366.19000 |
| PSA | 142.78000 |
| LogP | 1.46240 |
| Index of Refraction | 1.553 |
| InChIKey | UHBQBUZMKXTUBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)NN |
|
~54%
L-Serine,N-[N-[... CAS#:32899-48-2 |
| Literature: Hashimoto; Tamaki; Sofuku; Muramatsu Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 5 p. 1533 - 1541 |
|
~%
L-Serine,N-[N-[... CAS#:32899-48-2 |
| Literature: Hashimoto; Tamaki; Sofuku; Muramatsu Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 5 p. 1533 - 1541 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| t-Butyloxycarbonyl-Phe-Ser-NHNH2 |
| Boc-Phe-Ser-N2H3 |
| Boc-Phe-Ser-NHNH2 |
| tert-butyloxycarbonyl-L-phenylalanyl-L-serine hydrazide |