Methyl 3-amino-5-fluoro-4-methoxybenzoate
Methyl 3-amino-5-fluoro-4-methoxybenzoate structure
|
Common Name | Methyl 3-amino-5-fluoro-4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 329-46-4 | Molecular Weight | 199.179 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 342.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H10FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.1±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-amino-5-fluoro-4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.7±42.0 °C at 760 mmHg |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.179 |
| Flash Point | 161.1±27.9 °C |
| Exact Mass | 199.064468 |
| PSA | 61.55000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | GYGCYBGUMQWDFF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N)c(OC)c(F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Amino-5-ethyl-6-phenyl-8-<3-guanyl-phenyl-diazo-amino>-phenanthridinium |
| Isometamidium |
| 3-Amino-5-fluor-4-methoxy-benzoesaeure-methylester |
| Methyl 3-amino-5-fluoro-4-methoxybenzoate |
| Benzoic acid, 3-amino-5-fluoro-4-methoxy-, methyl ester |
| 3-amino-5-fluoro-4-methoxy-benzoic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: CAS number of Methyl 3-amino-5-fluoro-4-methoxybenzoate is 329-46-4. |
| Q: What is the polar surface area (PSA) of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: Polar surface area (PSA) of Methyl 3-amino-5-fluoro-4-methoxybenzoate is 61.55000. |
| Q: What is the English name of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: The English name of Methyl 3-amino-5-fluoro-4-methoxybenzoate is Methyl 3-amino-5-fluoro-4-methoxybenzoate. |
| Q: What is the molecular weight of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: Molecular weight of Methyl 3-amino-5-fluoro-4-methoxybenzoate is 199.179. |
| Q: What English synonyms does Methyl 3-amino-5-fluoro-4-methoxybenzoate have? |
| A: English synonyms of Methyl 3-amino-5-fluoro-4-methoxybenzoate: 3-Amino-5-ethyl-6-phenyl-8--phenanthridinium, Isometamidium, 3-Amino-5-fluor-4-methoxy-benzoesaeure-methylester, Methyl 3-amino-5-fluoro-4-methoxybenzoate, Benzoic acid, 3-amino-5-fluoro-4-methoxy-, methyl ester, 3-amino-5-fluoro-4-methoxy-benzoic acid methyl ester. |
| Q: What is the LogP of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: LogP of Methyl 3-amino-5-fluoro-4-methoxybenzoate is 1.93. |
| Q: What is the boiling point of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: Boiling point of Methyl 3-amino-5-fluoro-4-methoxybenzoate is 342.7±42.0 °C at 760 mmHg. |
| Q: What is the InChIKey of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: InChIKey of Methyl 3-amino-5-fluoro-4-methoxybenzoate is GYGCYBGUMQWDFF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: SMILES notation of Methyl 3-amino-5-fluoro-4-methoxybenzoate is COC(=O)c1cc(N)c(OC)c(F)c1. |
| Q: What is the molecular formula of Methyl 3-amino-5-fluoro-4-methoxybenzoate? |
| A: Molecular formula of Methyl 3-amino-5-fluoro-4-methoxybenzoate is C9H10FNO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |