N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide
Modify Date: 2025-10-15 09:48:25
![N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide Structure](https://www.chemsrc.com/extcaspic/436/329054-53-7.png)
N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide structure
|
Common Name | N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 329054-53-7 | Molecular Weight | 409.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9BrN4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9BrN4O6 |
|---|---|
| Molecular Weight | 409.15 |
| InChIKey | HPQOXEXNQXROAL-FRKPEAEDSA-N |
| SMILES | O=C(NN=Cc1cc(Br)ccc1O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide? |
| A: The English name of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide is N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide. |
| Q: What is the CAS number of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide? |
| A: CAS number of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide is 329054-53-7. |
| Q: What is the molecular formula of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide? |
| A: Molecular formula of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide is C14H9BrN4O6. |
| Q: What is the SMILES notation of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide? |
| A: SMILES notation of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide is O=C(NN=Cc1cc(Br)ccc1O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1. |
| Q: What is the Chinese name of 329054-53-7? |
| A: Chinese name of 329054-53-7 is 329054-53-7. |
| Q: What is the molecular weight of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide? |
| A: Molecular weight of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide is 409.15. |
| Q: What is the InChIKey of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide? |
| A: InChIKey of N'-[(E)-(5-bromo-2-hydroxyphenyl)methylidene]-3,5-dinitrobenzohydrazide is HPQOXEXNQXROAL-FRKPEAEDSA-N. |