Phosphonium,(ferrocenylmethyl)triphenyl-, iodide (1:1) structure
|
Common Name | Phosphonium,(ferrocenylmethyl)triphenyl-, iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 32914-67-3 | Molecular Weight | 579.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H17FeIP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclopenta-1,3-diene,cyclopenta-2,4-dien-1-ylmethyl(triphenyl)phosphanium,iron(2+) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H17FeIP |
|---|---|
| Molecular Weight | 579.16900 |
| Exact Mass | 578.94600 |
| PSA | 13.59000 |
| LogP | 1.17300 |
| InChIKey | BTZKDJUVOAHWLQ-UHFFFAOYSA-N |
| SMILES | [Fe+2].c1cc[cH-]c1.c1ccc([P+](Cc2cc[cH-]c2)(c2ccccc2)c2ccccc2)cc1 |
| 1,2,3,4,5-Cyclopentanepentayl,1-[(triphenylphosphonio)methyl]-,compd. with 1,2,3,4,5-cyclopentanepentayl and iron salt (1:1:1) |