JR-AB2-011 structure
|
Common Name | JR-AB2-011 | ||
|---|---|---|---|---|
| CAS Number | 329182-61-8 | Molecular Weight | 398.282 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H14Cl2FN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JR-AB2-011JR-AB2-011 is a potent and selective inhibitor of mTORC2 kinase activity. It markedly reduces mTORC2 signaling and IC50 while enhancing apoptotic levels in GBM cells. |
| Name | 3-(3,4-Dichlorophenyl)-1-(4-fluorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H14Cl2FN3OS |
| Molecular Weight | 398.282 |
| Exact Mass | 397.021881 |
| LogP | 4.89 |
| Index of Refraction | 1.660 |
| InChIKey | TWTNZYABDOSOSR-UHFFFAOYSA-N |
| SMILES | CC1CN=C(N(C(=O)Nc2ccc(Cl)c(Cl)c2)c2ccc(F)cc2)S1 |
| Urea, N'-(3,4-dichlorophenyl)-N-(4,5-dihydro-5-methyl-2-thiazolyl)-N-(4-fluorophenyl)- |
| 3-(3,4-Dichlorophenyl)-1-(4-fluorophenyl)-1-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea |
| N'-(3,4-dichlorophenyl)-N-(4-fluorophenyl)-N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)urea |