benzyl 2,2,2-tribromoacetate structure
|
Common Name | benzyl 2,2,2-tribromoacetate | ||
|---|---|---|---|---|
| CAS Number | 32919-04-3 | Molecular Weight | 386.86300 | |
| Density | 2.127g/cm3 | Boiling Point | 335.7ºC at 760mmHg | |
| Molecular Formula | C9H7Br3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.8ºC | |
| Name | benzyl 2,2,2-tribromoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.127g/cm3 |
|---|---|
| Boiling Point | 335.7ºC at 760mmHg |
| Molecular Formula | C9H7Br3O2 |
| Molecular Weight | 386.86300 |
| Flash Point | 156.8ºC |
| Exact Mass | 383.80000 |
| PSA | 26.30000 |
| LogP | 3.56830 |
| Index of Refraction | 1.638 |
| InChIKey | JYMUNLHUZAPKLC-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)C(Br)(Br)Br |
| HS Code | 2915900090 |
|---|
|
~%
benzyl 2,2,2-tr... CAS#:32919-04-3 |
| Literature: Traven',V.F.; Stepanov,B.I. Journal of Organic Chemistry USSR (English Translation), 1971 , vol. 7, # 3 p. 517 - 519 Zhurnal Organicheskoi Khimii, 1971 , vol. 7, # 3 p. 511 - 513 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Tribromessigsaeurebenzylester |
| Benzyl tribromoacetate |
| EINECS 251-297-0 |