2-(4-formylphenoxy)-N-pyridin-2-ylacetamide structure
|
Common Name | 2-(4-formylphenoxy)-N-pyridin-2-ylacetamide | ||
|---|---|---|---|---|
| CAS Number | 329211-31-6 | Molecular Weight | 256.25700 | |
| Density | 1.308g/cm3 | Boiling Point | 552.5ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.9ºC | |
| Name | 2-(4-formylphenoxy)-N-pyridin-2-ylacetamide |
|---|
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 552.5ºC at 760 mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 287.9ºC |
| Exact Mass | 256.08500 |
| PSA | 68.29000 |
| LogP | 1.98460 |
| Index of Refraction | 1.652 |
| InChIKey | MBUHKGWMCRLFTD-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OCC(=O)Nc2ccccn2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |