2-(4-Methyl-2-nitrophenoxy)acetohydrazide
Modify Date: 2025-08-26 15:07:45
2-(4-Methyl-2-nitrophenoxy)acetohydrazide structure
|
Common Name | 2-(4-Methyl-2-nitrophenoxy)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 329222-71-1 | Molecular Weight | 225.20100 | |
| Density | 1.343g/cm3 | Boiling Point | 511.4ºC at 760 mmHg | |
| Molecular Formula | C9H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | 2-(4-Methyl-2-nitrophenoxy)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 511.4ºC at 760 mmHg |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20100 |
| Flash Point | 263.1ºC |
| Exact Mass | 225.07500 |
| PSA | 110.17000 |
| LogP | 1.88630 |
| Index of Refraction | 1.583 |
| InChIKey | JYBQVXBOOOHKPW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCC(=O)NN)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(2-quinolin-6-yl-1h-indol-3-yl)-ethylamine |