2,2′-thiobis(4,6-di-tert-butylphenol)
2,2′-thiobis(4,6-di-tert-butylphenol) structure
|
Common Name | 2,2′-thiobis(4,6-di-tert-butylphenol) | ||
|---|---|---|---|---|
| CAS Number | 3293-91-2 | Molecular Weight | 442.697 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 486.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C28H42O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.0±27.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.6±45.0 °C at 760 mmHg |
| Molecular Formula | C28H42O2S |
| Molecular Weight | 442.697 |
| Flash Point | 236.0±27.4 °C |
| Exact Mass | 442.290558 |
| PSA | 65.76000 |
| LogP | 9.29 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | ANJHKVLUGKEZJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Sc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2930909090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:83698-85-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'6,6'-di-tert-butyl-2,2'-thiobisphenol |
| 2,2'-thiobis(4,6-di-tert-butylphenol) |
| 2,2'-Sulfanediylbis[4,6-bis(2-methyl-2-propanyl)phenol] |
| 4,46,6-DI-TERT-BUTYL-2,2-THIOBISPHENOL |
| 4,46,6-di-tert-butyl-2 ,2-thiobisphenol |
| 2,2'-dithiobis(4,6-di-tert-butylphenol) |
| 2,2'-thiobis(4,6-di(tert-butyl)phenol) |
| 2,2′-thiobis(4,6-di-tert-butylphenol) |
| 2,2'-thiobis(2,4-di-tert-butylphenole) |
| 2,2'-thiobis(2,4-di-tert-butylphenol) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: Boiling point of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is 486.6±45.0 °C at 760 mmHg. |
| Q: What English synonyms does 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] have? |
| A: English synonyms of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]: 4,4'6,6'-di-tert-butyl-2,2'-thiobisphenol, 2,2'-thiobis(4,6-di-tert-butylphenol), 2,2'-Sulfanediylbis[4,6-bis(2-methyl-2-propanyl)phenol], 4,46,6-DI-TERT-BUTYL-2,2-THIOBISPHENOL, 4,46,6-di-tert-butyl-2 ,2-thiobisphenol, 2,2'-dithiobis(4,6-di-tert-butylphenol), 2,2'-thiobis(4,6-di(tert-butyl)phenol), 2,2′-thiobis(4,6-di-tert-butylphenol), 2,2'-thiobis(2,4-di-tert-butylphenole), 2,2'-thiobis(2,4-di-tert-butylphenol). |
| Q: What is the InChIKey of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: InChIKey of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is ANJHKVLUGKEZJB-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: Polar surface area (PSA) of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is 65.76000. |
| Q: What is the CAS number of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: CAS number of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is 3293-91-2. |
| Q: What is the molecular formula of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: Molecular formula of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is C28H42O2S. |
| Q: What is the LogP of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: LogP of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is 9.29. |
| Q: What is the Chinese name of 3293-91-2? |
| A: Chinese name of 3293-91-2 is 3293-91-2. |
| Q: What is the English name of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: The English name of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]. |
| Q: What is the molecular weight of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol]? |
| A: Molecular weight of 2,2'-thiobis[4,6-bis(1,1-dimethylethyl)phenol] is 442.697. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |